Mercury, chloro(5-chloro-2-furanyl)-
CAS No: 3403-83-6
Furan
3403-83-6
mercury,chloro,furanyl,furan,3403-83-6
2025-10-18 Discover Mercury, chloro(5-chloro-2-furanyl)- (CAS No: 3403-83-6) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.