4-[(4-Aminophenyl)sulfonyl]benzoic acid methyl ester

CAS No: 34037-45-1

34037-45-1
3403-83-6 Mercury, chloro(5-chloro-2-furanyl)-
230313-53-8 Mn.O.Pb.Ti
34034-69-0 Thallium, (4,5,6,7-tetrahydro-4,7-methano-1H-inden-1-yl)-
34039-11-7 2-Phenylazo-1,4-benzenediol
34045-17-5 Phosphinous acid, dioctyl-
34034-67-8 Thallium, (1-methyl-2,4-cyclopentadien-1-yl)-
34045-35-7 Phosphonochloridic acid, (2-chloroethyl)-, 2-chloroethyl ester
34039-14-0 1,4-Benzenediol, 2-[(4-nitrophenyl)azo]-
34043-60-2 Benzene, [(1,1-dimethyl-2-propenyl)thio]-
34036-28-7 ETHYL 2-CHLOROTHIOPHENE-5-GLYOXYLATE
34037-14-4 Pyridine, 1,2-dihydro-2-methylene-
3404-23-7 Androst-5-ene-3beta,17beta,19-triol
3403-71-2 (-)-Mitorubrin
34039-56-0 methyl 5-{(3Z)-3-[4-(methoxycarbonyl)-3H-pyrazol-3-ylidene]triazanyl}-1H-pyrazole-4-carboxylate
34046-07-6 N-ALPHA-CARBOBENZOXY,N-ALPHA-(N-BETA-T-BUTOXYCARBONYL-ETHYL)-GLYCINE
34035-05-7 5-(4-methylphenyl)-2-furaldehyde(SALTDATA: FREE)
34039-60-6 methyl (3E)-3-(3,3-dimethyltriazanylidene)-3H-pyrazole-4-carboxylate
34037-45-1 4-[(4-Aminophenyl)sulfonyl]benzoic acid methyl ester
34035-97-7 ammonium pertechnetate
34034-29-2 1H-Pyrido[3,4-b]indol-1-one, 2,3,4,9-tetrahydro-9-(phenylmethyl)-
34037-45-1 aminophenyl,sulfonyl,benzoic,methyl,ester,34037-45-1
2025-10-19 Discover 4-[(4-Aminophenyl)sulfonyl]benzoic acid methyl ester (CAS No: 34037-45-1) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.